C42H62O8 — CID 22408787
[5-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylperoxy]-2,5-dimethylhex-3-yn-2-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propaneperoxoate (PubChem CID 22408787) has the molecular formula C42H62O8 and a molecular weight of 694.95 g/mol. Its IUPAC name is [5-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylperoxy]-2,5-dimethylhex-3-yn-2-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propaneperoxoate.
| Compound Name | [5-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylperoxy]-2,5-dimethylhex-3-yn-2-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propaneperoxoate |
|---|---|
| PubChem CID | 22408787 |
| Molecular Formula | C42H62O8 |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 694.44 |
| IUPAC Name | [5-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylperoxy]-2,5-dimethylhex-3-yn-2-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propaneperoxoate |
| SMILES | CC(C)(C#CC(C)(C)OOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H62O8/c1-37(2,3)29-23-27(24-30(35(29)45)38(4,5)6)17-19-33(43)47-49-41(13,14)21-22-42(15,16)50-48-34(44)20-18-28-25-31(39(7,8)9)36(46)32(26-28)40(10,11)12/h23-26,45-46H,17-20H2,1-16H3 |
| InChIKey | LQLSQZCVJWLNBU-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|