C33H43NO5 — CID 91543623
ethane;phenyl 2-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylamino]phenoxy]acetate (PubChem CID 91543623) has the molecular formula C33H43NO5 and a molecular weight of 533.71 g/mol. Its IUPAC name is ethane;phenyl 2-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylamino]phenoxy]acetate.
| Compound Name | ethane;phenyl 2-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 91543623 |
| Molecular Formula | C33H43NO5 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | ethane;phenyl 2-[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylamino]phenoxy]acetate |
| SMILES | CC.CC(C)(C)c1cc(CCC(=O)Nc2ccc(OCC(=O)Oc3ccccc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H37NO5.C2H6/c1-30(2,3)25-18-21(19-26(29(25)35)31(4,5)6)12-17-27(33)32-22-13-15-23(16-14-22)36-20-28(34)37-24-10-8-7-9-11-24;1-2/h7-11,13-16,18-19,35H,12,17,20H2,1-6H3,(H,32,33);1-2H3 |
| InChIKey | AROKHHMLDLBXFQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|