C32H49NO2 — CID 58031341
3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-octoxyphenyl)propanamide (PubChem CID 58031341) has the molecular formula C32H49NO2 and a molecular weight of 479.75 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-octoxyphenyl)propanamide.
| Compound Name | 3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-octoxyphenyl)propanamide |
|---|---|
| PubChem CID | 58031341 |
| Molecular Formula | C32H49NO2 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.38 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-octoxyphenyl)propanamide |
| SMILES | CCCCCCCCOc1ccc(NC(=O)CCc2cc(C(C)(C)C)c(C)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C32H49NO2/c1-9-10-11-12-13-14-21-35-27-18-16-26(17-19-27)33-30(34)20-15-25-22-28(31(3,4)5)24(2)29(23-25)32(6,7)8/h16-19,22-23H,9-15,20-21H2,1-8H3,(H,33,34) |
| InChIKey | OJJPTYGSXNJYCH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|