C25H35NO2 — CID 59266075
3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-methoxyphenyl)propanamide (PubChem CID 59266075) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-methoxyphenyl)propanamide.
| Compound Name | 3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 59266075 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-methylphenyl)-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCc2cc(C(C)(C)C)c(C)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C25H35NO2/c1-17-21(24(2,3)4)15-18(16-22(17)25(5,6)7)9-14-23(27)26-19-10-12-20(28-8)13-11-19/h10-13,15-16H,9,14H2,1-8H3,(H,26,27) |
| InChIKey | YTUPPUZGJWWAJI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |