C25H35NO3Y-2 — CID 58729890
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-hydroxybenzene-5-id-1-yl)propanamide;ethane;yttrium (PubChem CID 58729890) has the molecular formula C25H35NO3Y-2 and a molecular weight of 486.47 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-hydroxybenzene-5-id-1-yl)propanamide;ethane;yttrium.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-hydroxybenzene-5-id-1-yl)propanamide;ethane;yttrium |
|---|---|
| PubChem CID | 58729890 |
| Molecular Formula | C25H35NO3Y-2 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-hydroxybenzene-5-id-1-yl)propanamide;ethane;yttrium |
| SMILES | CC(C)(C)c1cc(CCC(=O)Nc2c[c-]c(O)cc2)cc(C(C)(C)C)c1O.[CH2-]C.[Y] |
| InChI | InChI=1S/C23H30NO3.C2H5.Y/c1-22(2,3)18-13-15(14-19(21(18)27)23(4,5)6)7-12-20(26)24-16-8-10-17(25)11-9-16;1-2;/h8-10,13-14,25,27H,7,12H2,1-6H3,(H,24,26);1H2,2H3;/q2*-1; |
| InChIKey | SNSCQRDLDMEIIT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|