C31H46N2O4 — CID 20728649
3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-N'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide (PubChem CID 20728649) has the molecular formula C31H46N2O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-N'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide.
| Compound Name | 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-N'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 20728649 |
| Molecular Formula | C31H46N2O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-N'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide |
| SMILES | Cc1cc(CCC(=O)NNC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H46N2O4/c1-19-15-20(16-22(27(19)36)29(2,3)4)11-13-25(34)32-33-26(35)14-12-21-17-23(30(5,6)7)28(37)24(18-21)31(8,9)10/h15-18,36-37H,11-14H2,1-10H3,(H,32,34)(H,33,35) |
| InChIKey | AXSFMFIRPVVDDB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|