C19H30N2O3 — CID 741717
N'-acetyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide (PubChem CID 741717) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N'-acetyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide.
| Compound Name | N'-acetyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 741717 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N'-acetyl-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide |
| SMILES | CC(=O)NNC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-12(22)20-21-16(23)9-8-13-10-14(18(2,3)4)17(24)15(11-13)19(5,6)7/h10-11,24H,8-9H2,1-7H3,(H,20,22)(H,21,23) |
| InChIKey | YNPFIPPTVWPBNO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|