C20H34N2O4 — CID 139775524
2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoylamino]ethyl-dimethylazanium acetate (PubChem CID 139775524) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoylamino]ethyl-dimethylazanium acetate.
| Compound Name | 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoylamino]ethyl-dimethylazanium acetate |
|---|---|
| PubChem CID | 139775524 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoylamino]ethyl-dimethylazanium acetate |
| SMILES | CC(=O)[O-].Cc1cc(CCC(=O)NCC[NH+](C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H30N2O2.C2H4O2/c1-13-11-14(12-15(17(13)22)18(2,3)4)7-8-16(21)19-9-10-20(5)6;1-2(3)4/h11-12,22H,7-10H2,1-6H3,(H,19,21);1H3,(H,3,4) |
| InChIKey | PNDBQLCTVDJBQI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |