C21H37N3O2 — CID 172793531
N-[2-(2-aminoethylamino)ethyl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanamide (PubChem CID 172793531) has the molecular formula C21H37N3O2 and a molecular weight of 363.55 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanamide.
| Compound Name | N-[2-(2-aminoethylamino)ethyl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 172793531 |
| Molecular Formula | C21H37N3O2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanamide |
| SMILES | CC(C)(C)c1cc(CCC(=O)NCCNCCN)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H37N3O2/c1-20(2,3)16-13-15(14-17(19(16)26)21(4,5)6)7-8-18(25)24-12-11-23-10-9-22/h13-14,23,26H,7-12,22H2,1-6H3,(H,24,25) |
| InChIKey | PWVRGVFMEHYHSD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|