C20H34N2O2 — CID 22104700
N-(2-aminoethyl)-3-(3,5-ditert-butyl-4-methoxyphenyl)propanamide (PubChem CID 22104700) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(3,5-ditert-butyl-4-methoxyphenyl)propanamide.
| Compound Name | N-(2-aminoethyl)-3-(3,5-ditert-butyl-4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 22104700 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | N-(2-aminoethyl)-3-(3,5-ditert-butyl-4-methoxyphenyl)propanamide |
| SMILES | COc1c(C(C)(C)C)cc(CCC(=O)NCCN)cc1C(C)(C)C |
| InChI | InChI=1S/C20H34N2O2/c1-19(2,3)15-12-14(8-9-17(23)22-11-10-21)13-16(18(15)24-7)20(4,5)6/h12-13H,8-11,21H2,1-7H3,(H,22,23) |
| InChIKey | YOHRHJDWXUJOSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |