C51H81NO8 — CID 158061096
tert-butyl [2,6-ditert-butyl-4-[3-[[10-[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-8-oxodecyl]amino]-3-oxopropyl]phenyl] carbonate (PubChem CID 158061096) has the molecular formula C51H81NO8 and a molecular weight of 836.21 g/mol. Its IUPAC name is tert-butyl [2,6-ditert-butyl-4-[3-[[10-[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-8-oxodecyl]amino]-3-oxopropyl]phenyl] carbonate.
| Compound Name | tert-butyl [2,6-ditert-butyl-4-[3-[[10-[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-8-oxodecyl]amino]-3-oxopropyl]phenyl] carbonate |
|---|---|
| PubChem CID | 158061096 |
| Molecular Formula | C51H81NO8 |
| Molecular Weight | 836.21 g/mol |
| Exact Mass | 835.60 |
| IUPAC Name | tert-butyl [2,6-ditert-butyl-4-[3-[[10-[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-8-oxodecyl]amino]-3-oxopropyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1c(C(C)(C)C)cc(CCC(=O)CCCCCCCNC(=O)CCc2cc(C(C)(C)C)c(OC(=O)OC(C)(C)C)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C51H81NO8/c1-46(2,3)37-30-34(31-38(47(4,5)6)42(37)57-44(55)59-50(13,14)15)25-27-36(53)24-22-20-19-21-23-29-52-41(54)28-26-35-32-39(48(7,8)9)43(40(33-35)49(10,11)12)58-45(56)60-51(16,17)18/h30-33H,19-29H2,1-18H3,(H,52,54) |
| InChIKey | DIYUYIXQESXNLA-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.21 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|