C24H45NO4 — CID 149247722
tert-butyl 13-(4,4-dimethylpentanoylamino)-8-oxotridecanoate (PubChem CID 149247722) has the molecular formula C24H45NO4 and a molecular weight of 411.63 g/mol. Its IUPAC name is tert-butyl 13-(4,4-dimethylpentanoylamino)-8-oxotridecanoate.
| Compound Name | tert-butyl 13-(4,4-dimethylpentanoylamino)-8-oxotridecanoate |
|---|---|
| PubChem CID | 149247722 |
| Molecular Formula | C24H45NO4 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | tert-butyl 13-(4,4-dimethylpentanoylamino)-8-oxotridecanoate |
| SMILES | CC(C)(C)CCC(=O)NCCCCCC(=O)CCCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45NO4/c1-23(2,3)18-17-21(27)25-19-13-9-11-15-20(26)14-10-7-8-12-16-22(28)29-24(4,5)6/h7-19H2,1-6H3,(H,25,27) |
| InChIKey | XNKZAPVLZKDREK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|