C21H42N2O2 — CID 164953894
3-(tert-butylamino)-N-(11,11-dimethyl-8-oxododecyl)propanamide (PubChem CID 164953894) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 3-(tert-butylamino)-N-(11,11-dimethyl-8-oxododecyl)propanamide.
| Compound Name | 3-(tert-butylamino)-N-(11,11-dimethyl-8-oxododecyl)propanamide |
|---|---|
| PubChem CID | 164953894 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | 3-(tert-butylamino)-N-(11,11-dimethyl-8-oxododecyl)propanamide |
| SMILES | CC(C)(C)CCC(=O)CCCCCCCNC(=O)CCNC(C)(C)C |
| InChI | InChI=1S/C21H42N2O2/c1-20(2,3)15-13-18(24)12-10-8-7-9-11-16-22-19(25)14-17-23-21(4,5)6/h23H,7-17H2,1-6H3,(H,22,25) |
| InChIKey | DCHCUGYCQALDBN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|