C16H31NO2 — CID 166884720
N-(5,5-dimethyl-2-oxohexyl)octanamide (PubChem CID 166884720) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is N-(5,5-dimethyl-2-oxohexyl)octanamide.
| Compound Name | N-(5,5-dimethyl-2-oxohexyl)octanamide |
|---|---|
| PubChem CID | 166884720 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | N-(5,5-dimethyl-2-oxohexyl)octanamide |
| SMILES | CCCCCCCC(=O)NCC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-5-6-7-8-9-10-15(19)17-13-14(18)11-12-16(2,3)4/h5-13H2,1-4H3,(H,17,19) |
| InChIKey | MDMWNMYKZPETPI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|