C12H21NO4 — CID 163453905
5-(4,4-dimethylpentanoylamino)-4-oxopentanoic acid (PubChem CID 163453905) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 5-(4,4-dimethylpentanoylamino)-4-oxopentanoic acid.
| Compound Name | 5-(4,4-dimethylpentanoylamino)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 163453905 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 5-(4,4-dimethylpentanoylamino)-4-oxopentanoic acid |
| SMILES | CC(C)(C)CCC(=O)NCC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H21NO4/c1-12(2,3)7-6-10(15)13-8-9(14)4-5-11(16)17/h4-8H2,1-3H3,(H,13,15)(H,16,17) |
| InChIKey | JZJRKEISICYFQH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |