C18H36N2O2 — CID 130398409
N-[3-(tert-butylamino)propyl]-8,8-dimethyl-6-oxononanamide (PubChem CID 130398409) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is N-[3-(tert-butylamino)propyl]-8,8-dimethyl-6-oxononanamide.
| Compound Name | N-[3-(tert-butylamino)propyl]-8,8-dimethyl-6-oxononanamide |
|---|---|
| PubChem CID | 130398409 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | N-[3-(tert-butylamino)propyl]-8,8-dimethyl-6-oxononanamide |
| SMILES | CC(C)(C)CC(=O)CCCCC(=O)NCCCNC(C)(C)C |
| InChI | InChI=1S/C18H36N2O2/c1-17(2,3)14-15(21)10-7-8-11-16(22)19-12-9-13-20-18(4,5)6/h20H,7-14H2,1-6H3,(H,19,22) |
| InChIKey | CGICBMGOFQVAOR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|