C24H46N4O4 — CID 159147171
1-tert-butyl-3-[9-[(6,6-dimethyl-4-oxoheptyl)carbamoylamino]-4-oxononyl]urea (PubChem CID 159147171) has the molecular formula C24H46N4O4 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1-tert-butyl-3-[9-[(6,6-dimethyl-4-oxoheptyl)carbamoylamino]-4-oxononyl]urea.
| Compound Name | 1-tert-butyl-3-[9-[(6,6-dimethyl-4-oxoheptyl)carbamoylamino]-4-oxononyl]urea |
|---|---|
| PubChem CID | 159147171 |
| Molecular Formula | C24H46N4O4 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | 1-tert-butyl-3-[9-[(6,6-dimethyl-4-oxoheptyl)carbamoylamino]-4-oxononyl]urea |
| SMILES | CC(C)(C)CC(=O)CCCNC(=O)NCCCCCC(=O)CCCNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C24H46N4O4/c1-23(2,3)18-20(30)14-11-16-26-21(31)25-15-9-7-8-12-19(29)13-10-17-27-22(32)28-24(4,5)6/h7-18H2,1-6H3,(H2,25,26,31)(H2,27,28,32) |
| InChIKey | XKQCYCYDAQOTDV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|