C19H36O2 — CID 158540576
2,2,14,14-tetramethylpentadecane-4,12-dione (PubChem CID 158540576) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,2,14,14-tetramethylpentadecane-4,12-dione.
| Compound Name | 2,2,14,14-tetramethylpentadecane-4,12-dione |
|---|---|
| PubChem CID | 158540576 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2,2,14,14-tetramethylpentadecane-4,12-dione |
| SMILES | CC(C)(C)CC(=O)CCCCCCCC(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H36O2/c1-18(2,3)14-16(20)12-10-8-7-9-11-13-17(21)15-19(4,5)6/h7-15H2,1-6H3 |
| InChIKey | PHSHHIXRKFNLEZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|