C14H32O — CID 160856578
methane;2,2,7,7-tetramethyloctan-4-one (PubChem CID 160856578) has the molecular formula C14H32O and a molecular weight of 216.41 g/mol. Its IUPAC name is methane;2,2,7,7-tetramethyloctan-4-one.
| Compound Name | methane;2,2,7,7-tetramethyloctan-4-one |
|---|---|
| PubChem CID | 160856578 |
| Molecular Formula | C14H32O |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.25 |
| IUPAC Name | methane;2,2,7,7-tetramethyloctan-4-one |
| SMILES | C.C.CC(C)(C)CCC(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H24O.2CH4/c1-11(2,3)8-7-10(13)9-12(4,5)6;;/h7-9H2,1-6H3;2*1H4 |
| InChIKey | SJYAHVLLFZIVEC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |