C28H60N2O — CID 167538898
N-tert-butylcyclopropanamine;2,2,7,7-tetramethyloctan-4-one;N,N,4,4-tetramethylpentan-1-amine (PubChem CID 167538898) has the molecular formula C28H60N2O and a molecular weight of 440.80 g/mol. Its IUPAC name is N-tert-butylcyclopropanamine;2,2,7,7-tetramethyloctan-4-one;N,N,4,4-tetramethylpentan-1-amine.
| Compound Name | N-tert-butylcyclopropanamine;2,2,7,7-tetramethyloctan-4-one;N,N,4,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 167538898 |
| Molecular Formula | C28H60N2O |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.47 |
| IUPAC Name | N-tert-butylcyclopropanamine;2,2,7,7-tetramethyloctan-4-one;N,N,4,4-tetramethylpentan-1-amine |
| SMILES | CC(C)(C)CCC(=O)CC(C)(C)C.CC(C)(C)NC1CC1.CN(C)CCCC(C)(C)C |
| InChI | InChI=1S/C12H24O.C9H21N.C7H15N/c1-11(2,3)8-7-10(13)9-12(4,5)6;1-9(2,3)7-6-8-10(4)5;1-7(2,3)8-6-4-5-6/h7-9H2,1-6H3;6-8H2,1-5H3;6,8H,4-5H2,1-3H3 |
| InChIKey | AXGUKGSGRJNBAG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |