C13H25N3O2 — CID 108957385
N-cyclopropyl-N'-[3-(dimethylamino)propyl]-2,2-dimethylpropanediamide (PubChem CID 108957385) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-cyclopropyl-N'-[3-(dimethylamino)propyl]-2,2-dimethylpropanediamide.
| Compound Name | N-cyclopropyl-N'-[3-(dimethylamino)propyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108957385 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-cyclopropyl-N'-[3-(dimethylamino)propyl]-2,2-dimethylpropanediamide |
| SMILES | CN(C)CCCNC(=O)C(C)(C)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H25N3O2/c1-13(2,12(18)15-10-6-7-10)11(17)14-8-5-9-16(3)4/h10H,5-9H2,1-4H3,(H,14,17)(H,15,18) |
| InChIKey | PFGIWSYLUWWMLS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|