C18H29N3O2 — CID 108960576
N-[3-(dimethylamino)propyl]-N'-(3,5-dimethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108960576) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-(3,5-dimethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N'-(3,5-dimethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108960576 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-(3,5-dimethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)(C)C(=O)NCCCN(C)C)c1 |
| InChI | InChI=1S/C18H29N3O2/c1-13-10-14(2)12-15(11-13)20-17(23)18(3,4)16(22)19-8-7-9-21(5)6/h10-12H,7-9H2,1-6H3,(H,19,22)(H,20,23) |
| InChIKey | SRYLMIKFSBLPLA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|