C17H24F3N3O2 — CID 108960617
N-[3-(dimethylamino)propyl]-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108960617) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108960617 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CN(C)CCCNC(=O)C(C)(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-16(2,14(24)21-9-6-10-23(3)4)15(25)22-13-8-5-7-12(11-13)17(18,19)20/h5,7-8,11H,6,9-10H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | SEZJHSZWEZWWTP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|