C23H24ClF6N3O2 — CID 42701910
3-chloro-2,2-dimethyl-N-[3-[3-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]propyl]propanamide (PubChem CID 42701910) has the molecular formula C23H24ClF6N3O2 and a molecular weight of 523.91 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[3-[3-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]propyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[3-[3-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]propyl]propanamide |
|---|---|
| PubChem CID | 42701910 |
| Molecular Formula | C23H24ClF6N3O2 |
| Molecular Weight | 523.91 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[3-[3-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]propyl]propanamide |
| SMILES | CC(C)(CCl)C(=O)NCCCN(C(=O)Nc1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24ClF6N3O2/c1-21(2,14-24)19(34)31-10-5-11-33(18-9-4-7-16(13-18)23(28,29)30)20(35)32-17-8-3-6-15(12-17)22(25,26)27/h3-4,6-9,12-13H,5,10-11,14H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | HGJOXKSNJZXPME-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.91 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|