C25H24ClF3N4O3 — CID 42702313
3-(4-chlorophenyl)-1-[3-[(4-methoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 42702313) has the molecular formula C25H24ClF3N4O3 and a molecular weight of 520.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[3-[(4-methoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 3-(4-chlorophenyl)-1-[3-[(4-methoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42702313 |
| Molecular Formula | C25H24ClF3N4O3 |
| Molecular Weight | 520.94 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[3-[(4-methoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(NC(=O)NCCCN(C(=O)Nc2ccc(Cl)cc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H24ClF3N4O3/c1-36-22-12-10-19(11-13-22)31-23(34)30-14-3-15-33(21-5-2-4-17(16-21)25(27,28)29)24(35)32-20-8-6-18(26)7-9-20/h2,4-13,16H,3,14-15H2,1H3,(H,32,35)(H2,30,31,34) |
| InChIKey | UAMMAUQMRNXFOH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.94 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|