C24H24Cl2N4O3 — CID 3618741
3-(3-chlorophenyl)-1-[3-[(3-chlorophenyl)carbamoylamino]propyl]-1-(4-methoxyphenyl)urea (PubChem CID 3618741) has the molecular formula C24H24Cl2N4O3 and a molecular weight of 487.39 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-[(3-chlorophenyl)carbamoylamino]propyl]-1-(4-methoxyphenyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-[(3-chlorophenyl)carbamoylamino]propyl]-1-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 3618741 |
| Molecular Formula | C24H24Cl2N4O3 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-[(3-chlorophenyl)carbamoylamino]propyl]-1-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(N(CCCNC(=O)Nc2cccc(Cl)c2)C(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H24Cl2N4O3/c1-33-22-11-9-21(10-12-22)30(24(32)29-20-8-3-6-18(26)16-20)14-4-13-27-23(31)28-19-7-2-5-17(25)15-19/h2-3,5-12,15-16H,4,13-14H2,1H3,(H,29,32)(H2,27,28,31) |
| InChIKey | ICPHKRKZVVIVQL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|