C30H29ClN4O3S — CID 42705604
3-(3-chlorophenyl)-1-[3-[(4-methylsulfanylphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea (PubChem CID 42705604) has the molecular formula C30H29ClN4O3S and a molecular weight of 561.11 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-[(4-methylsulfanylphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-[(4-methylsulfanylphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42705604 |
| Molecular Formula | C30H29ClN4O3S |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-[(4-methylsulfanylphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea |
| SMILES | CSc1ccc(NC(=O)NCCCN(C(=O)Nc2cccc(Cl)c2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H29ClN4O3S/c1-39-28-17-11-23(12-18-28)33-29(36)32-19-6-20-35(30(37)34-24-8-5-7-22(31)21-24)25-13-15-27(16-14-25)38-26-9-3-2-4-10-26/h2-5,7-18,21H,6,19-20H2,1H3,(H,34,37)(H2,32,33,36) |
| InChIKey | VAIBDWPVFPKILV-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|