C31H32N4O5 — CID 3919297
3-(4-methoxyphenyl)-1-[3-[(2-methoxyphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea (PubChem CID 3919297) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[3-[(2-methoxyphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea.
| Compound Name | 3-(4-methoxyphenyl)-1-[3-[(2-methoxyphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 3919297 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[3-[(2-methoxyphenyl)carbamoylamino]propyl]-1-(4-phenoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(CCCNC(=O)Nc2ccccc2OC)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H32N4O5/c1-38-25-17-13-23(14-18-25)33-31(37)35(24-15-19-27(20-16-24)40-26-9-4-3-5-10-26)22-8-21-32-30(36)34-28-11-6-7-12-29(28)39-2/h3-7,9-20H,8,21-22H2,1-2H3,(H,33,37)(H2,32,34,36) |
| InChIKey | MIHPGBAXIXEZEL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|