C30H35N3O4 — CID 42707093
N-[3-[N-[(4-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]cyclohexanecarboxamide (PubChem CID 42707093) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[3-[N-[(4-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[N-[(4-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42707093 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-[3-[N-[(4-methoxyphenyl)carbamoyl]-4-phenoxyanilino]propyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(NC(=O)N(CCCNC(=O)C2CCCCC2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O4/c1-36-26-17-13-24(14-18-26)32-30(35)33(22-8-21-31-29(34)23-9-4-2-5-10-23)25-15-19-28(20-16-25)37-27-11-6-3-7-12-27/h3,6-7,11-20,23H,2,4-5,8-10,21-22H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | JINIJCULLQEDEM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|