C25H28N4O3 — CID 42702260
1-[3-[(3-methoxyphenyl)carbamoylamino]propyl]-3-(4-methylphenyl)-1-phenylurea (PubChem CID 42702260) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[3-[(3-methoxyphenyl)carbamoylamino]propyl]-3-(4-methylphenyl)-1-phenylurea.
| Compound Name | 1-[3-[(3-methoxyphenyl)carbamoylamino]propyl]-3-(4-methylphenyl)-1-phenylurea |
|---|---|
| PubChem CID | 42702260 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-[3-[(3-methoxyphenyl)carbamoylamino]propyl]-3-(4-methylphenyl)-1-phenylurea |
| SMILES | COc1cccc(NC(=O)NCCCN(C(=O)Nc2ccc(C)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H28N4O3/c1-19-12-14-20(15-13-19)28-25(31)29(22-9-4-3-5-10-22)17-7-16-26-24(30)27-21-8-6-11-23(18-21)32-2/h3-6,8-15,18H,7,16-17H2,1-2H3,(H,28,31)(H2,26,27,30) |
| InChIKey | LXIPYZTTWRZBNF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|