C23H21Cl2FN4O2 — CID 42705924
3-(3,4-dichlorophenyl)-1-[3-[(3-fluorophenyl)carbamoylamino]propyl]-1-phenylurea (PubChem CID 42705924) has the molecular formula C23H21Cl2FN4O2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[3-[(3-fluorophenyl)carbamoylamino]propyl]-1-phenylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[3-[(3-fluorophenyl)carbamoylamino]propyl]-1-phenylurea |
|---|---|
| PubChem CID | 42705924 |
| Molecular Formula | C23H21Cl2FN4O2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[3-[(3-fluorophenyl)carbamoylamino]propyl]-1-phenylurea |
| SMILES | O=C(NCCCN(C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccccc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H21Cl2FN4O2/c24-20-11-10-18(15-21(20)25)29-23(32)30(19-8-2-1-3-9-19)13-5-12-27-22(31)28-17-7-4-6-16(26)14-17/h1-4,6-11,14-15H,5,12-13H2,(H,29,32)(H2,27,28,31) |
| InChIKey | FQJAEKHFVJCWQW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|