C22H20Cl2FN3O3S — CID 42705928
3-(3,4-dichlorophenyl)-1-[3-[(4-fluorophenyl)sulfonylamino]propyl]-1-phenylurea (PubChem CID 42705928) has the molecular formula C22H20Cl2FN3O3S and a molecular weight of 496.39 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[3-[(4-fluorophenyl)sulfonylamino]propyl]-1-phenylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[3-[(4-fluorophenyl)sulfonylamino]propyl]-1-phenylurea |
|---|---|
| PubChem CID | 42705928 |
| Molecular Formula | C22H20Cl2FN3O3S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[3-[(4-fluorophenyl)sulfonylamino]propyl]-1-phenylurea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N(CCCNS(=O)(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20Cl2FN3O3S/c23-20-12-9-17(15-21(20)24)27-22(29)28(18-5-2-1-3-6-18)14-4-13-26-32(30,31)19-10-7-16(25)8-11-19/h1-3,5-12,15,26H,4,13-14H2,(H,27,29) |
| InChIKey | RRHSZZWPHYEQBT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|