C22H19ClFN5O7S — CID 42657227
1-[3-[(4-chloro-3-nitrophenyl)sulfonylamino]propyl]-1-(4-fluorophenyl)-3-(4-nitrophenyl)urea (PubChem CID 42657227) has the molecular formula C22H19ClFN5O7S and a molecular weight of 551.94 g/mol. Its IUPAC name is 1-[3-[(4-chloro-3-nitrophenyl)sulfonylamino]propyl]-1-(4-fluorophenyl)-3-(4-nitrophenyl)urea.
| Compound Name | 1-[3-[(4-chloro-3-nitrophenyl)sulfonylamino]propyl]-1-(4-fluorophenyl)-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42657227 |
| Molecular Formula | C22H19ClFN5O7S |
| Molecular Weight | 551.94 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 1-[3-[(4-chloro-3-nitrophenyl)sulfonylamino]propyl]-1-(4-fluorophenyl)-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N(CCCNS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19ClFN5O7S/c23-20-11-10-19(14-21(20)29(33)34)37(35,36)25-12-1-13-27(17-6-2-15(24)3-7-17)22(30)26-16-4-8-18(9-5-16)28(31)32/h2-11,14,25H,1,12-13H2,(H,26,30) |
| InChIKey | ZEUVMNFNCOKLEJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|