C23H22FN5O5 — CID 4233640
1-(4-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)urea (PubChem CID 4233640) has the molecular formula C23H22FN5O5 and a molecular weight of 467.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-(4-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 4233640 |
| Molecular Formula | C23H22FN5O5 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-(4-fluorophenyl)-1-[2-[(4-methoxyphenyl)carbamoylamino]ethyl]-3-(4-nitrophenyl)urea |
| SMILES | COc1ccc(NC(=O)NCCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H22FN5O5/c1-34-21-12-6-17(7-13-21)26-22(30)25-14-15-28(19-8-2-16(24)3-9-19)23(31)27-18-4-10-20(11-5-18)29(32)33/h2-13H,14-15H2,1H3,(H,27,31)(H2,25,26,30) |
| InChIKey | WZRVJTFLWFNMRX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|