C23H21F2N3O3 — CID 42707208
3-fluoro-N-[2-[4-fluoro-N-[(4-methoxyphenyl)carbamoyl]anilino]ethyl]benzamide (PubChem CID 42707208) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-fluoro-N-[2-[4-fluoro-N-[(4-methoxyphenyl)carbamoyl]anilino]ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[4-fluoro-N-[(4-methoxyphenyl)carbamoyl]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 42707208 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-fluoro-N-[2-[4-fluoro-N-[(4-methoxyphenyl)carbamoyl]anilino]ethyl]benzamide |
| SMILES | COc1ccc(NC(=O)N(CCNC(=O)c2cccc(F)c2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-31-21-11-7-19(8-12-21)27-23(30)28(20-9-5-17(24)6-10-20)14-13-26-22(29)16-3-2-4-18(25)15-16/h2-12,15H,13-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | DSYBBJZFKJOLPB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |