C24H24FN3O2 — CID 42725862
N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]benzamide (PubChem CID 42725862) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]benzamide.
| Compound Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]benzamide |
|---|---|
| PubChem CID | 42725862 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]benzamide |
| SMILES | Cc1ccc(NC(=O)N(CCCNC(=O)c2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H24FN3O2/c1-18-8-12-21(13-9-18)27-24(30)28(22-14-10-20(25)11-15-22)17-5-16-26-23(29)19-6-3-2-4-7-19/h2-4,6-15H,5,16-17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | DXLOUQKTESWHBH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|