C24H32FN3O2 — CID 42726462
N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]heptanamide (PubChem CID 42726462) has the molecular formula C24H32FN3O2 and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]heptanamide.
| Compound Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]heptanamide |
|---|---|
| PubChem CID | 42726462 |
| Molecular Formula | C24H32FN3O2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-[3-[4-fluoro-N-[(4-methylphenyl)carbamoyl]anilino]propyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCCN(C(=O)Nc1ccc(C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O2/c1-3-4-5-6-8-23(29)26-17-7-18-28(22-15-11-20(25)12-16-22)24(30)27-21-13-9-19(2)10-14-21/h9-16H,3-8,17-18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | HPKVBCHYPJZRHR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|