C25H34FN3O2 — CID 42707250
N-[2-[4-fluoro-N-[(2-methylphenyl)carbamoyl]anilino]ethyl]nonanamide (PubChem CID 42707250) has the molecular formula C25H34FN3O2 and a molecular weight of 427.56 g/mol. Its IUPAC name is N-[2-[4-fluoro-N-[(2-methylphenyl)carbamoyl]anilino]ethyl]nonanamide.
| Compound Name | N-[2-[4-fluoro-N-[(2-methylphenyl)carbamoyl]anilino]ethyl]nonanamide |
|---|---|
| PubChem CID | 42707250 |
| Molecular Formula | C25H34FN3O2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-[2-[4-fluoro-N-[(2-methylphenyl)carbamoyl]anilino]ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCCN(C(=O)Nc1ccccc1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H34FN3O2/c1-3-4-5-6-7-8-13-24(30)27-18-19-29(22-16-14-21(26)15-17-22)25(31)28-23-12-10-9-11-20(23)2/h9-12,14-17H,3-8,13,18-19H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | DKMWZKGQFHBXCN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|