C30H37N3O3 — CID 42705829
N-[3-[N-[(3-methylphenyl)carbamoyl]-4-phenoxyanilino]propyl]heptanamide (PubChem CID 42705829) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-[3-[N-[(3-methylphenyl)carbamoyl]-4-phenoxyanilino]propyl]heptanamide.
| Compound Name | N-[3-[N-[(3-methylphenyl)carbamoyl]-4-phenoxyanilino]propyl]heptanamide |
|---|---|
| PubChem CID | 42705829 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-[3-[N-[(3-methylphenyl)carbamoyl]-4-phenoxyanilino]propyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCCN(C(=O)Nc1cccc(C)c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H37N3O3/c1-3-4-5-9-16-29(34)31-21-11-22-33(30(35)32-25-13-10-12-24(2)23-25)26-17-19-28(20-18-26)36-27-14-7-6-8-15-27/h6-8,10,12-15,17-20,23H,3-5,9,11,16,21-22H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | BNLBMNNDVXWVLM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|