C33H30N4O3 — CID 42726273
3-(3-methylphenyl)-1-[2-(naphthalen-1-ylcarbamoylamino)ethyl]-1-(4-phenoxyphenyl)urea (PubChem CID 42726273) has the molecular formula C33H30N4O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1-[2-(naphthalen-1-ylcarbamoylamino)ethyl]-1-(4-phenoxyphenyl)urea.
| Compound Name | 3-(3-methylphenyl)-1-[2-(naphthalen-1-ylcarbamoylamino)ethyl]-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42726273 |
| Molecular Formula | C33H30N4O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 3-(3-methylphenyl)-1-[2-(naphthalen-1-ylcarbamoylamino)ethyl]-1-(4-phenoxyphenyl)urea |
| SMILES | Cc1cccc(NC(=O)N(CCNC(=O)Nc2cccc3ccccc23)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H30N4O3/c1-24-9-7-12-26(23-24)35-33(39)37(27-17-19-29(20-18-27)40-28-13-3-2-4-14-28)22-21-34-32(38)36-31-16-8-11-25-10-5-6-15-30(25)31/h2-20,23H,21-22H2,1H3,(H,35,39)(H2,34,36,38) |
| InChIKey | OAMPRFLEDCHHKR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |