C30H29FN4O4 — CID 42725951
1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-3-(2-fluorophenyl)-1-(4-phenoxyphenyl)urea (PubChem CID 42725951) has the molecular formula C30H29FN4O4 and a molecular weight of 528.58 g/mol. Its IUPAC name is 1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-3-(2-fluorophenyl)-1-(4-phenoxyphenyl)urea.
| Compound Name | 1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-3-(2-fluorophenyl)-1-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 42725951 |
| Molecular Formula | C30H29FN4O4 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-3-(2-fluorophenyl)-1-(4-phenoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCN(C(=O)Nc2ccccc2F)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H29FN4O4/c1-2-38-24-16-12-22(13-17-24)33-29(36)32-20-21-35(30(37)34-28-11-7-6-10-27(28)31)23-14-18-26(19-15-23)39-25-8-4-3-5-9-25/h3-19H,2,20-21H2,1H3,(H,34,37)(H2,32,33,36) |
| InChIKey | COMMQIRIGPUMSB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |