C24H23FN2O2 — CID 42696272
1-(4-ethoxyphenyl)-3-(2-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea (PubChem CID 42696272) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(2-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(2-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 42696272 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(2-fluorophenyl)-1-[(E)-3-phenylprop-2-enyl]urea |
| SMILES | CCOc1ccc(N(C/C=C/c2ccccc2)C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C24H23FN2O2/c1-2-29-21-16-14-20(15-17-21)27(18-8-11-19-9-4-3-5-10-19)24(28)26-23-13-7-6-12-22(23)25/h3-17H,2,18H2,1H3,(H,26,28)/b11-8+ |
| InChIKey | SKINFIDGWOBVBX-DHZHZOJOSA-N |
| XLogP | 5.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |