C25H26F2N4O3 — CID 42705745
1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-3-(2-fluorophenyl)-1-(4-fluorophenyl)urea (PubChem CID 42705745) has the molecular formula C25H26F2N4O3 and a molecular weight of 468.50 g/mol. Its IUPAC name is 1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-3-(2-fluorophenyl)-1-(4-fluorophenyl)urea.
| Compound Name | 1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-3-(2-fluorophenyl)-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 42705745 |
| Molecular Formula | C25H26F2N4O3 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-3-(2-fluorophenyl)-1-(4-fluorophenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCCN(C(=O)Nc2ccccc2F)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H26F2N4O3/c1-2-34-21-14-10-19(11-15-21)29-24(32)28-16-5-17-31(20-12-8-18(26)9-13-20)25(33)30-23-7-4-3-6-22(23)27/h3-4,6-15H,2,5,16-17H2,1H3,(H,30,33)(H2,28,29,32) |
| InChIKey | YOANZNOGKGEQTB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|