C21H26ClFN4O2 — CID 42704493
1-[3-(butylcarbamoylamino)propyl]-3-(4-chlorophenyl)-1-(4-fluorophenyl)urea (PubChem CID 42704493) has the molecular formula C21H26ClFN4O2 and a molecular weight of 420.92 g/mol. Its IUPAC name is 1-[3-(butylcarbamoylamino)propyl]-3-(4-chlorophenyl)-1-(4-fluorophenyl)urea.
| Compound Name | 1-[3-(butylcarbamoylamino)propyl]-3-(4-chlorophenyl)-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 42704493 |
| Molecular Formula | C21H26ClFN4O2 |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[3-(butylcarbamoylamino)propyl]-3-(4-chlorophenyl)-1-(4-fluorophenyl)urea |
| SMILES | CCCCNC(=O)NCCCN(C(=O)Nc1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26ClFN4O2/c1-2-3-13-24-20(28)25-14-4-15-27(19-11-7-17(23)8-12-19)21(29)26-18-9-5-16(22)6-10-18/h5-12H,2-4,13-15H2,1H3,(H,26,29)(H2,24,25,28) |
| InChIKey | HVPOXWWIQFHLSO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|