C24H24ClFN4O3 — CID 42705518
3-(4-chlorophenyl)-1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-1-(4-fluorophenyl)urea (PubChem CID 42705518) has the molecular formula C24H24ClFN4O3 and a molecular weight of 470.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-1-(4-fluorophenyl)urea.
| Compound Name | 3-(4-chlorophenyl)-1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 42705518 |
| Molecular Formula | C24H24ClFN4O3 |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[2-[(4-ethoxyphenyl)carbamoylamino]ethyl]-1-(4-fluorophenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCN(C(=O)Nc2ccc(Cl)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H24ClFN4O3/c1-2-33-22-13-9-19(10-14-22)28-23(31)27-15-16-30(21-11-5-18(26)6-12-21)24(32)29-20-7-3-17(25)4-8-20/h3-14H,2,15-16H2,1H3,(H,29,32)(H2,27,28,31) |
| InChIKey | DLRQMAUAKUPQPK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |