C16H17ClN2O3 — CID 108890719
1-(4-chlorophenyl)-3-[(4-ethoxyphenoxy)methyl]urea (PubChem CID 108890719) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4-ethoxyphenoxy)methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4-ethoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108890719 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4-ethoxyphenoxy)methyl]urea |
| SMILES | CCOc1ccc(OCNC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-2-21-14-7-9-15(10-8-14)22-11-18-16(20)19-13-5-3-12(17)4-6-13/h3-10H,2,11H2,1H3,(H2,18,19,20) |
| InChIKey | ZLOHSBMDTPBCOJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|