C17H20N2O4 — CID 108892159
1-(4-ethoxyphenyl)-3-[(2-methoxyphenoxy)methyl]urea (PubChem CID 108892159) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[(2-methoxyphenoxy)methyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[(2-methoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108892159 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[(2-methoxyphenoxy)methyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCOc2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-3-22-14-10-8-13(9-11-14)19-17(20)18-12-23-16-7-5-4-6-15(16)21-2/h4-11H,3,12H2,1-2H3,(H2,18,19,20) |
| InChIKey | FYBVTBOOZWPKFJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|