C17H20N2O4 — CID 108892792
1-(3,4-dimethoxyphenyl)-3-[(4-methylphenoxy)methyl]urea (PubChem CID 108892792) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(4-methylphenoxy)methyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(4-methylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108892792 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(4-methylphenoxy)methyl]urea |
| SMILES | COc1ccc(NC(=O)NCOc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H20N2O4/c1-12-4-7-14(8-5-12)23-11-18-17(20)19-13-6-9-15(21-2)16(10-13)22-3/h4-10H,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | JNAHBSKQFSLRPS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|