C18H22N2O2 — CID 108870709
1-[(2,4-dimethylphenoxy)methyl]-3-(3,4-dimethylphenyl)urea (PubChem CID 108870709) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenoxy)methyl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[(2,4-dimethylphenoxy)methyl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108870709 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[(2,4-dimethylphenoxy)methyl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(OCNC(=O)Nc2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-12-5-8-17(15(4)9-12)22-11-19-18(21)20-16-7-6-13(2)14(3)10-16/h5-10H,11H2,1-4H3,(H2,19,20,21) |
| InChIKey | DWTPBHXWWIBMJZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|