C20H26N2O3 — CID 108877128
1-(4-butylphenyl)-3-[(2-ethoxyphenoxy)methyl]urea (PubChem CID 108877128) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(2-ethoxyphenoxy)methyl]urea.
| Compound Name | 1-(4-butylphenyl)-3-[(2-ethoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108877128 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(2-ethoxyphenoxy)methyl]urea |
| SMILES | CCCCc1ccc(NC(=O)NCOc2ccccc2OCC)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-3-5-8-16-11-13-17(14-12-16)22-20(23)21-15-25-19-10-7-6-9-18(19)24-4-2/h6-7,9-14H,3-5,8,15H2,1-2H3,(H2,21,22,23) |
| InChIKey | FTQRVYCLRIICKB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|